C25H32FNO — CID 143571390
acetylene;4-[(1E,3Z,5E)-3-amino-6-(2-fluorophenyl)hepta-1,3,5-trienyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol (PubChem CID 143571390) has the molecular formula C25H32FNO and a molecular weight of 381.54 g/mol. Its IUPAC name is acetylene;4-[(1E,3Z,5E)-3-amino-6-(2-fluorophenyl)hepta-1,3,5-trienyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol.
| Compound Name | acetylene;4-[(1E,3Z,5E)-3-amino-6-(2-fluorophenyl)hepta-1,3,5-trienyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 143571390 |
| Molecular Formula | C25H32FNO |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | acetylene;4-[(1E,3Z,5E)-3-amino-6-(2-fluorophenyl)hepta-1,3,5-trienyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
| SMILES | C#C.C/C(=C\C=C(N)\C=C\C1CC(O)CC2CCCCC12)c1ccccc1F |
| InChI | InChI=1S/C23H30FNO.C2H2/c1-16(21-7-4-5-9-23(21)24)10-12-19(25)13-11-18-15-20(26)14-17-6-2-3-8-22(17)18;1-2/h4-5,7,9-13,17-18,20,22,26H,2-3,6,8,14-15,25H2,1H3;1-2H/b13-11+,16-10+,19-12-; |
| InChIKey | HCXUCQFGSSFMJP-SCFPNSPKSA-N |
| XLogP | 5.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|