C14H18F2O2 — CID 144811099
acetylene;cyclohexane-1,4-diol;1,2-difluorobenzene (PubChem CID 144811099) has the molecular formula C14H18F2O2 and a molecular weight of 256.29 g/mol. Its IUPAC name is acetylene;cyclohexane-1,4-diol;1,2-difluorobenzene.
| Compound Name | acetylene;cyclohexane-1,4-diol;1,2-difluorobenzene |
|---|---|
| PubChem CID | 144811099 |
| Molecular Formula | C14H18F2O2 |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | acetylene;cyclohexane-1,4-diol;1,2-difluorobenzene |
| SMILES | C#C.Fc1ccccc1F.OC1CCC(O)CC1 |
| InChI | InChI=1S/C6H4F2.C6H12O2.C2H2/c7-5-3-1-2-4-6(5)8;7-5-1-2-6(8)4-3-5;1-2/h1-4H;5-8H,1-4H2;1-2H |
| InChIKey | CZYBQRIXIYHASX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|