C17H21FN2O2 — CID 94649821
(E)-N-(2-amino-2-oxoethyl)-N-cyclopentyl-3-(2-fluorophenyl)but-2-enamide (PubChem CID 94649821) has the molecular formula C17H21FN2O2 and a molecular weight of 304.36 g/mol. Its IUPAC name is (E)-N-(2-amino-2-oxoethyl)-N-cyclopentyl-3-(2-fluorophenyl)but-2-enamide.
| Compound Name | (E)-N-(2-amino-2-oxoethyl)-N-cyclopentyl-3-(2-fluorophenyl)but-2-enamide |
|---|---|
| PubChem CID | 94649821 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (E)-N-(2-amino-2-oxoethyl)-N-cyclopentyl-3-(2-fluorophenyl)but-2-enamide |
| SMILES | C/C(=C\C(=O)N(CC(N)=O)C1CCCC1)c1ccccc1F |
| InChI | InChI=1S/C17H21FN2O2/c1-12(14-8-4-5-9-15(14)18)10-17(22)20(11-16(19)21)13-6-2-3-7-13/h4-5,8-10,13H,2-3,6-7,11H2,1H3,(H2,19,21)/b12-10+ |
| InChIKey | CSQGEBAQDZCWSV-ZRDIBKRKSA-N |
| XLogP | 2.49 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|