C26H29N5O2S2 — CID 143572344
[2-(2-ethyl-3-hydrazinylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-(4-methylsulfanylphenyl)methanol (PubChem CID 143572344) has the molecular formula C26H29N5O2S2 and a molecular weight of 507.69 g/mol. Its IUPAC name is [2-(2-ethyl-3-hydrazinylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-(4-methylsulfanylphenyl)methanol.
| Compound Name | [2-(2-ethyl-3-hydrazinylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-(4-methylsulfanylphenyl)methanol |
|---|---|
| PubChem CID | 143572344 |
| Molecular Formula | C26H29N5O2S2 |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | [2-(2-ethyl-3-hydrazinylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-(4-methylsulfanylphenyl)methanol |
| SMILES | CCc1c(NN)cccc1-c1nc(N2CCOCC2)c2sc(C(O)c3ccc(SC)cc3)cc2n1 |
| InChI | InChI=1S/C26H29N5O2S2/c1-3-18-19(5-4-6-20(18)30-27)25-28-21-15-22(23(32)16-7-9-17(34-2)10-8-16)35-24(21)26(29-25)31-11-13-33-14-12-31/h4-10,15,23,30,32H,3,11-14,27H2,1-2H3 |
| InChIKey | VQOMUMFMUSGBJA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|