C37H36N6O5S2 — CID 163206677
bis[2-ethyl-3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] carbonate (PubChem CID 163206677) has the molecular formula C37H36N6O5S2 and a molecular weight of 708.87 g/mol. Its IUPAC name is bis[2-ethyl-3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] carbonate.
| Compound Name | bis[2-ethyl-3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] carbonate |
|---|---|
| PubChem CID | 163206677 |
| Molecular Formula | C37H36N6O5S2 |
| Molecular Weight | 708.87 g/mol |
| Exact Mass | 708.22 |
| IUPAC Name | bis[2-ethyl-3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] carbonate |
| SMILES | CCc1c(OC(=O)Oc2cccc(-c3nc(N4CCOCC4)c4sccc4n3)c2CC)cccc1-c1nc(N2CCOCC2)c2sccc2n1 |
| InChI | InChI=1S/C37H36N6O5S2/c1-3-23-25(33-38-27-11-21-49-31(27)35(40-33)42-13-17-45-18-14-42)7-5-9-29(23)47-37(44)48-30-10-6-8-26(24(30)4-2)34-39-28-12-22-50-32(28)36(41-34)43-15-19-46-20-16-43/h5-12,21-22H,3-4,13-20H2,1-2H3 |
| InChIKey | CBLCMKNMLIERQG-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 112.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.87 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|