C26H33N3O3S — CID 154618039
[3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] decanoate (PubChem CID 154618039) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is [3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] decanoate.
| Compound Name | [3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] decanoate |
|---|---|
| PubChem CID | 154618039 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | [3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] decanoate |
| SMILES | CCCCCCCCCC(=O)Oc1cccc(-c2nc(N3CCOCC3)c3sccc3n2)c1 |
| InChI | InChI=1S/C26H33N3O3S/c1-2-3-4-5-6-7-8-12-23(30)32-21-11-9-10-20(19-21)25-27-22-13-18-33-24(22)26(28-25)29-14-16-31-17-15-29/h9-11,13,18-19H,2-8,12,14-17H2,1H3 |
| InChIKey | HKALBEBYUORISE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|