C20H21N3O3S — CID 154618056
[3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] butanoate (PubChem CID 154618056) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is [3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] butanoate.
| Compound Name | [3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] butanoate |
|---|---|
| PubChem CID | 154618056 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] butanoate |
| SMILES | CCCC(=O)Oc1cccc(-c2nc(N3CCOCC3)c3sccc3n2)c1 |
| InChI | InChI=1S/C20H21N3O3S/c1-2-4-17(24)26-15-6-3-5-14(13-15)19-21-16-7-12-27-18(16)20(22-19)23-8-10-25-11-9-23/h3,5-7,12-13H,2,4,8-11H2,1H3 |
| InChIKey | PEMOTUNBHQLIPU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|