C38H39ClN6O8S2 — CID 158923662
ethyl carbonochloridate;ethyl [3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] carbonate;3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenol (PubChem CID 158923662) has the molecular formula C38H39ClN6O8S2 and a molecular weight of 807.35 g/mol. Its IUPAC name is ethyl carbonochloridate;ethyl [3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] carbonate;3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenol.
| Compound Name | ethyl carbonochloridate;ethyl [3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] carbonate;3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenol |
|---|---|
| PubChem CID | 158923662 |
| Molecular Formula | C38H39ClN6O8S2 |
| Molecular Weight | 807.35 g/mol |
| Exact Mass | 806.20 |
| IUPAC Name | ethyl carbonochloridate;ethyl [3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenyl] carbonate;3-(4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl)phenol |
| SMILES | CCOC(=O)Cl.CCOC(=O)Oc1cccc(-c2nc(N3CCOCC3)c3sccc3n2)c1.Oc1cccc(-c2nc(N3CCOCC3)c3sccc3n2)c1 |
| InChI | InChI=1S/C19H19N3O4S.C16H15N3O2S.C3H5ClO2/c1-2-25-19(23)26-14-5-3-4-13(12-14)17-20-15-6-11-27-16(15)18(21-17)22-7-9-24-10-8-22;20-12-3-1-2-11(10-12)15-17-13-4-9-22-14(13)16(18-15)19-5-7-21-8-6-19;1-2-6-3(4)5/h3-6,11-12H,2,7-10H2,1H3;1-4,9-10,20H,5-8H2;2H2,1H3 |
| InChIKey | JIDUMVAIYVXIKI-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 158.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.35 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|