C25H30N10O3 — CID 143573322
1-[4-[(N-aminoanilino)-hydrazinylmethyl]piperazin-1-yl]-2-[4-methoxy-7-(5-methyl-1H-pyrazol-3-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 143573322) has the molecular formula C25H30N10O3 and a molecular weight of 518.58 g/mol. Its IUPAC name is 1-[4-[(N-aminoanilino)-hydrazinylmethyl]piperazin-1-yl]-2-[4-methoxy-7-(5-methyl-1H-pyrazol-3-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[4-[(N-aminoanilino)-hydrazinylmethyl]piperazin-1-yl]-2-[4-methoxy-7-(5-methyl-1H-pyrazol-3-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 143573322 |
| Molecular Formula | C25H30N10O3 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 1-[4-[(N-aminoanilino)-hydrazinylmethyl]piperazin-1-yl]-2-[4-methoxy-7-(5-methyl-1H-pyrazol-3-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | COc1cnc(-c2cc(C)[nH]n2)c2[nH]cc(C(=O)C(=O)N3CCN(C(NN)N(N)c4ccccc4)CC3)c12 |
| InChI | InChI=1S/C25H30N10O3/c1-15-12-18(32-31-15)21-22-20(19(38-2)14-29-21)17(13-28-22)23(36)24(37)33-8-10-34(11-9-33)25(30-26)35(27)16-6-4-3-5-7-16/h3-7,12-14,25,28,30H,8-11,26-27H2,1-2H3,(H,31,32) |
| InChIKey | SPEWQTMNFNPOFD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 174.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|