C24H27FN10O2 — CID 143573605
1-[4-[(N-aminoanilino)-hydrazinylmethyl]piperazin-1-yl]-2-[4-fluoro-7-(5-methylpyrazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 143573605) has the molecular formula C24H27FN10O2 and a molecular weight of 506.55 g/mol. Its IUPAC name is 1-[4-[(N-aminoanilino)-hydrazinylmethyl]piperazin-1-yl]-2-[4-fluoro-7-(5-methylpyrazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[4-[(N-aminoanilino)-hydrazinylmethyl]piperazin-1-yl]-2-[4-fluoro-7-(5-methylpyrazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 143573605 |
| Molecular Formula | C24H27FN10O2 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 1-[4-[(N-aminoanilino)-hydrazinylmethyl]piperazin-1-yl]-2-[4-fluoro-7-(5-methylpyrazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | Cc1ccnn1-c1ncc(F)c2c(C(=O)C(=O)N3CCN(C(NN)N(N)c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C24H27FN10O2/c1-15-7-8-30-35(15)22-20-19(18(25)14-29-22)17(13-28-20)21(36)23(37)32-9-11-33(12-10-32)24(31-26)34(27)16-5-3-2-4-6-16/h2-8,13-14,24,28,31H,9-12,26-27H2,1H3 |
| InChIKey | RXYRCPWVANEXRX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 154.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|