C19H21FN4O2S — CID 143575799
2-amino-N-benzyl-4-methyl-1,3-thiazole-5-carboxamide;N-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]formamide (PubChem CID 143575799) has the molecular formula C19H21FN4O2S and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-amino-N-benzyl-4-methyl-1,3-thiazole-5-carboxamide;N-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]formamide.
| Compound Name | 2-amino-N-benzyl-4-methyl-1,3-thiazole-5-carboxamide;N-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]formamide |
|---|---|
| PubChem CID | 143575799 |
| Molecular Formula | C19H21FN4O2S |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-amino-N-benzyl-4-methyl-1,3-thiazole-5-carboxamide;N-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]formamide |
| SMILES | C=C(F)/C=C\C(=C)NC=O.Cc1nc(N)sc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C12H13N3OS.C7H8FNO/c1-8-10(17-12(13)15-8)11(16)14-7-9-5-3-2-4-6-9;1-6(8)3-4-7(2)9-5-10/h2-6H,7H2,1H3,(H2,13,15)(H,14,16);3-5H,1-2H2,(H,9,10)/b;4-3- |
| InChIKey | UVRHIQVAVVBEAJ-QGAMPUOQSA-N |
| XLogP | 3.25 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|