C19H26N2O2S — CID 143697957
N-benzyl-2-[(Z)-1-ethoxyprop-1-enyl]-4-methyl-1,3-thiazole-5-carboxamide;ethane (PubChem CID 143697957) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-benzyl-2-[(Z)-1-ethoxyprop-1-enyl]-4-methyl-1,3-thiazole-5-carboxamide;ethane.
| Compound Name | N-benzyl-2-[(Z)-1-ethoxyprop-1-enyl]-4-methyl-1,3-thiazole-5-carboxamide;ethane |
|---|---|
| PubChem CID | 143697957 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-benzyl-2-[(Z)-1-ethoxyprop-1-enyl]-4-methyl-1,3-thiazole-5-carboxamide;ethane |
| SMILES | C/C=C(\OCC)c1nc(C)c(C(=O)NCc2ccccc2)s1.CC |
| InChI | InChI=1S/C17H20N2O2S.C2H6/c1-4-14(21-5-2)17-19-12(3)15(22-17)16(20)18-11-13-9-7-6-8-10-13;1-2/h4,6-10H,5,11H2,1-3H3,(H,18,20);1-2H3/b14-4-; |
| InChIKey | BVWLHGVYKIMANR-CYBPKNTASA-N |
| XLogP | 4.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|