C15H22O4 — CID 14357583
(1S,3R,6R,7R,9R,10R,11R,13R)-11-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradecan-5-one (PubChem CID 14357583) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1S,3R,6R,7R,9R,10R,11R,13R)-11-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradecan-5-one.
| Compound Name | (1S,3R,6R,7R,9R,10R,11R,13R)-11-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradecan-5-one |
|---|---|
| PubChem CID | 14357583 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1S,3R,6R,7R,9R,10R,11R,13R)-11-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradecan-5-one |
| SMILES | C[C@H]1C(=O)O[C@@H]2C[C@@]34O[C@@H]3C[C@@H](O)[C@H](C)[C@@]4(C)C[C@@H]21 |
| InChI | InChI=1S/C15H22O4/c1-7-9-5-14(3)8(2)10(16)4-12-15(14,19-12)6-11(9)18-13(7)17/h7-12,16H,4-6H2,1-3H3/t7-,8+,9-,10-,11-,12-,14-,15-/m1/s1 |
| InChIKey | FHPVBZKSIDMPHU-ZZUJXLLWSA-N |
| XLogP | 1.50 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|