C19H27NO — CID 143575870
(2R,3'R,11bR)-3'-methyl-3-(2-methylpropyl)spiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane] (PubChem CID 143575870) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (2R,3'R,11bR)-3'-methyl-3-(2-methylpropyl)spiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane].
| Compound Name | (2R,3'R,11bR)-3'-methyl-3-(2-methylpropyl)spiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane] |
|---|---|
| PubChem CID | 143575870 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (2R,3'R,11bR)-3'-methyl-3-(2-methylpropyl)spiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane] |
| SMILES | CC(C)CC1CN2CCc3ccccc3[C@H]2C[C@@]12O[C@@H]2C |
| InChI | InChI=1S/C19H27NO/c1-13(2)10-16-12-20-9-8-15-6-4-5-7-17(15)18(20)11-19(16)14(3)21-19/h4-7,13-14,16,18H,8-12H2,1-3H3/t14-,16?,18-,19+/m1/s1 |
| InChIKey | WWXOYTYKXVABDF-DJXYKJKZSA-N |
| XLogP | 3.81 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|