C13H23NO — CID 143576268
(2E)-N-[(2-methylpropan-2-yl)oxymethyl]-2-prop-1-en-2-ylpenta-2,4-dien-1-amine (PubChem CID 143576268) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2E)-N-[(2-methylpropan-2-yl)oxymethyl]-2-prop-1-en-2-ylpenta-2,4-dien-1-amine.
| Compound Name | (2E)-N-[(2-methylpropan-2-yl)oxymethyl]-2-prop-1-en-2-ylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143576268 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2E)-N-[(2-methylpropan-2-yl)oxymethyl]-2-prop-1-en-2-ylpenta-2,4-dien-1-amine |
| SMILES | C=C/C=C(/CNCOC(C)(C)C)C(=C)C |
| InChI | InChI=1S/C13H23NO/c1-7-8-12(11(2)3)9-14-10-15-13(4,5)6/h7-8,14H,1-2,9-10H2,3-6H3/b12-8- |
| InChIKey | FWVLHULPWLSECV-WQLSENKSSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|