C24H16F3N3O2S — CID 143576767
N-[4-[2-[6-(2-acetylphenyl)-1H-benzimidazol-2-yl]ethynyl]phenyl]-1,1,1-trifluoromethanesulfinamide (PubChem CID 143576767) has the molecular formula C24H16F3N3O2S and a molecular weight of 467.47 g/mol. Its IUPAC name is N-[4-[2-[6-(2-acetylphenyl)-1H-benzimidazol-2-yl]ethynyl]phenyl]-1,1,1-trifluoromethanesulfinamide.
| Compound Name | N-[4-[2-[6-(2-acetylphenyl)-1H-benzimidazol-2-yl]ethynyl]phenyl]-1,1,1-trifluoromethanesulfinamide |
|---|---|
| PubChem CID | 143576767 |
| Molecular Formula | C24H16F3N3O2S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | N-[4-[2-[6-(2-acetylphenyl)-1H-benzimidazol-2-yl]ethynyl]phenyl]-1,1,1-trifluoromethanesulfinamide |
| SMILES | CC(=O)c1ccccc1-c1ccc2nc(C#Cc3ccc(NS(=O)C(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C24H16F3N3O2S/c1-15(31)19-4-2-3-5-20(19)17-9-12-21-22(14-17)29-23(28-21)13-8-16-6-10-18(11-7-16)30-33(32)24(25,26)27/h2-7,9-12,14,30H,1H3,(H,28,29) |
| InChIKey | WQKSPIYPGZOPNN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|