C19H27N — CID 143578838
(2E)-N-benzyl-N-ethyl-5-methyl-2-prop-1-en-2-ylhexa-2,4-dien-1-amine (PubChem CID 143578838) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is (2E)-N-benzyl-N-ethyl-5-methyl-2-prop-1-en-2-ylhexa-2,4-dien-1-amine.
| Compound Name | (2E)-N-benzyl-N-ethyl-5-methyl-2-prop-1-en-2-ylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143578838 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | (2E)-N-benzyl-N-ethyl-5-methyl-2-prop-1-en-2-ylhexa-2,4-dien-1-amine |
| SMILES | C=C(C)/C(=C\C=C(C)C)CN(CC)Cc1ccccc1 |
| InChI | InChI=1S/C19H27N/c1-6-20(14-18-10-8-7-9-11-18)15-19(17(4)5)13-12-16(2)3/h7-13H,4,6,14-15H2,1-3,5H3/b19-13- |
| InChIKey | YWYRVZTZGBRALS-UYRXBGFRSA-N |
| XLogP | 4.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|