C17H26N2O — CID 156793306
(1Z)-1-[2-[benzyl(ethyl)amino]ethyl-ethylamino]buta-1,3-dien-1-ol (PubChem CID 156793306) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (1Z)-1-[2-[benzyl(ethyl)amino]ethyl-ethylamino]buta-1,3-dien-1-ol.
| Compound Name | (1Z)-1-[2-[benzyl(ethyl)amino]ethyl-ethylamino]buta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 156793306 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (1Z)-1-[2-[benzyl(ethyl)amino]ethyl-ethylamino]buta-1,3-dien-1-ol |
| SMILES | C=C/C=C(\O)N(CC)CCN(CC)Cc1ccccc1 |
| InChI | InChI=1S/C17H26N2O/c1-4-10-17(20)19(6-3)14-13-18(5-2)15-16-11-8-7-9-12-16/h4,7-12,20H,1,5-6,13-15H2,2-3H3/b17-10- |
| InChIKey | MCSNVBYGKIJWLM-YVLHZVERSA-N |
| XLogP | 3.42 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|