C16H26ClNO — CID 143579646
4-[(2-chloro-4-propan-2-ylphenyl)methyl]morpholine;ethane (PubChem CID 143579646) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 4-[(2-chloro-4-propan-2-ylphenyl)methyl]morpholine;ethane.
| Compound Name | 4-[(2-chloro-4-propan-2-ylphenyl)methyl]morpholine;ethane |
|---|---|
| PubChem CID | 143579646 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 4-[(2-chloro-4-propan-2-ylphenyl)methyl]morpholine;ethane |
| SMILES | CC.CC(C)c1ccc(CN2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClNO.C2H6/c1-11(2)12-3-4-13(14(15)9-12)10-16-5-7-17-8-6-16;1-2/h3-4,9,11H,5-8,10H2,1-2H3;1-2H3 |
| InChIKey | OVTPTWKGBQFGSK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |