C13H18ClNOS — CID 91405859
4-[(2-chloro-4-ethylsulfanylphenyl)methyl]morpholine (PubChem CID 91405859) has the molecular formula C13H18ClNOS and a molecular weight of 271.81 g/mol. Its IUPAC name is 4-[(2-chloro-4-ethylsulfanylphenyl)methyl]morpholine.
| Compound Name | 4-[(2-chloro-4-ethylsulfanylphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 91405859 |
| Molecular Formula | C13H18ClNOS |
| Molecular Weight | 271.81 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-[(2-chloro-4-ethylsulfanylphenyl)methyl]morpholine |
| SMILES | CCSc1ccc(CN2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClNOS/c1-2-17-12-4-3-11(13(14)9-12)10-15-5-7-16-8-6-15/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | FLAQBEQESKUWKT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |