C18H19NO6 — CID 14358064
benzyl (3Z,4Z)-3,4-bis(2-methoxy-2-oxoethylidene)pyrrolidine-1-carboxylate (PubChem CID 14358064) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is benzyl (3Z,4Z)-3,4-bis(2-methoxy-2-oxoethylidene)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (3Z,4Z)-3,4-bis(2-methoxy-2-oxoethylidene)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 14358064 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | benzyl (3Z,4Z)-3,4-bis(2-methoxy-2-oxoethylidene)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)/C=C1\CN(C(=O)OCc2ccccc2)C\C1=C/C(=O)OC |
| InChI | InChI=1S/C18H19NO6/c1-23-16(20)8-14-10-19(11-15(14)9-17(21)24-2)18(22)25-12-13-6-4-3-5-7-13/h3-9H,10-12H2,1-2H3/b14-8+,15-9+ |
| InChIKey | NSDKLHBMCYWUIN-VOMDNODZSA-N |
| XLogP | 1.84 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|