C10H12Br2O — CID 143581922
2-(2,2-dibromoethenyl)phenol;ethane (PubChem CID 143581922) has the molecular formula C10H12Br2O and a molecular weight of 308.01 g/mol. Its IUPAC name is 2-(2,2-dibromoethenyl)phenol;ethane.
| Compound Name | 2-(2,2-dibromoethenyl)phenol;ethane |
|---|---|
| PubChem CID | 143581922 |
| Molecular Formula | C10H12Br2O |
| Molecular Weight | 308.01 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 2-(2,2-dibromoethenyl)phenol;ethane |
| SMILES | CC.Oc1ccccc1C=C(Br)Br |
| InChI | InChI=1S/C8H6Br2O.C2H6/c9-8(10)5-6-3-1-2-4-7(6)11;1-2/h1-5,11H;1-2H3 |
| InChIKey | GGHVHLAHZQPSRO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.01 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |