C9H7Br2NO — CID 10470333
2-(2,2-dibromoethenyl)benzamide (PubChem CID 10470333) has the molecular formula C9H7Br2NO and a molecular weight of 304.97 g/mol. Its IUPAC name is 2-(2,2-dibromoethenyl)benzamide.
| Compound Name | 2-(2,2-dibromoethenyl)benzamide |
|---|---|
| PubChem CID | 10470333 |
| Molecular Formula | C9H7Br2NO |
| Molecular Weight | 304.97 g/mol |
| Exact Mass | 302.89 |
| IUPAC Name | 2-(2,2-dibromoethenyl)benzamide |
| SMILES | NC(=O)c1ccccc1C=C(Br)Br |
| InChI | InChI=1S/C9H7Br2NO/c10-8(11)5-6-3-1-2-4-7(6)9(12)13/h1-5H,(H2,12,13) |
| InChIKey | QHYNAFIZOQORAY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.97 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |