C10H8F3NO — CID 69287667
2-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide (PubChem CID 69287667) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is 2-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide.
| Compound Name | 2-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 69287667 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide |
| SMILES | NC(=O)c1ccccc1/C=C/C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO/c11-10(12,13)6-5-7-3-1-2-4-8(7)9(14)15/h1-6H,(H2,14,15)/b6-5+ |
| InChIKey | DXXRKFXEDREVNL-AATRIKPKSA-N |
| XLogP | 2.36 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |