About 2-methanimidoylbenzamide
2-methanimidoylbenzamide (PubChem CID 123272130) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 2-methanimidoylbenzamide.
Molecular Properties
| Compound Name | 2-methanimidoylbenzamide |
| PubChem CID | 123272130 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2-methanimidoylbenzamide |
| SMILES | [H]/N=C/c1ccccc1C(N)=O |
| InChI | InChI=1S/C8H8N2O/c9-5-6-3-1-2-4-7(6)8(10)11/h1-5,9H,(H2,10,11)/b9-5+ |
| InChIKey | YMAYJWAJKZUMOJ-WEVVVXLNSA-N |
| XLogP | 0.78 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methanimidoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanimidoylbenzamide?
The IUPAC name of 2-methanimidoylbenzamide (CID 123272130) is 2-methanimidoylbenzamide.
What is the SMILES notation for 2-methanimidoylbenzamide?
The canonical SMILES for 2-methanimidoylbenzamide is [H]/N=C/c1ccccc1C(N)=O.
What is the InChIKey of 2-methanimidoylbenzamide?
The InChIKey is YMAYJWAJKZUMOJ-WEVVVXLNSA-N. The full InChI is InChI=1S/C8H8N2O/c9-5-6-3-1-2-4-7(6)8(10)11/h1-5,9H,(H2,10,11)/b9-5+.
What are the key properties of 2-methanimidoylbenzamide?
2-methanimidoylbenzamide has a molecular weight of 148.16 g/mol, XLogP of 0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanimidoylbenzamide is sourced from PubChem (CID 123272130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).