C14H17N3O4S — CID 139516888
2-[2-[2-[(2-methanimidoylbenzoyl)amino]ethylamino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 139516888) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-[2-[2-[(2-methanimidoylbenzoyl)amino]ethylamino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[2-[(2-methanimidoylbenzoyl)amino]ethylamino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 139516888 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-[2-[2-[(2-methanimidoylbenzoyl)amino]ethylamino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | [H]/N=C/c1ccccc1C(=O)NCCNC(=O)CSCC(=O)O |
| InChI | InChI=1S/C14H17N3O4S/c15-7-10-3-1-2-4-11(10)14(21)17-6-5-16-12(18)8-22-9-13(19)20/h1-4,7,15H,5-6,8-9H2,(H,16,18)(H,17,21)(H,19,20)/b15-7+ |
| InChIKey | DMKYOIJLWLMHJH-VIZOYTHASA-N |
| XLogP | 0.35 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|