C10H8F3N — CID 102396811
[2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]methanimine (PubChem CID 102396811) has the molecular formula C10H8F3N and a molecular weight of 199.18 g/mol. Its IUPAC name is [2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]methanimine.
| Compound Name | [2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 102396811 |
| Molecular Formula | C10H8F3N |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | [2-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]methanimine |
| SMILES | [H]/N=C/c1ccccc1C(=C)C(F)(F)F |
| InChI | InChI=1S/C10H8F3N/c1-7(10(11,12)13)9-5-3-2-4-8(9)6-14/h2-6,14H,1H2/b14-6+ |
| InChIKey | GQFCDBKICWUFHY-MKMNVTDBSA-N |
| XLogP | 3.26 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|