C24H29BrN2O4 — CID 143582546
(E)-7-(2-bromophenyl)-2-methoxyhept-6-enamide;5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 143582546) has the molecular formula C24H29BrN2O4 and a molecular weight of 489.41 g/mol. Its IUPAC name is (E)-7-(2-bromophenyl)-2-methoxyhept-6-enamide;5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | (E)-7-(2-bromophenyl)-2-methoxyhept-6-enamide;5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 143582546 |
| Molecular Formula | C24H29BrN2O4 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | (E)-7-(2-bromophenyl)-2-methoxyhept-6-enamide;5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CN1C(=O)CCOc2ccccc21.COC(CCC/C=C/c1ccccc1Br)C(N)=O |
| InChI | InChI=1S/C14H18BrNO2.C10H11NO2/c1-18-13(14(16)17)10-4-2-3-7-11-8-5-6-9-12(11)15;1-11-8-4-2-3-5-9(8)13-7-6-10(11)12/h3,5-9,13H,2,4,10H2,1H3,(H2,16,17);2-5H,6-7H2,1H3/b7-3+; |
| InChIKey | FHJCOPQQVHIJGH-CDQVLDCRSA-N |
| XLogP | 4.56 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|