C24H38N2O4 — CID 143582583
(E)-2-methoxy-8,8-dimethylnon-6-enamide;5-propyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 143582583) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is (E)-2-methoxy-8,8-dimethylnon-6-enamide;5-propyl-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | (E)-2-methoxy-8,8-dimethylnon-6-enamide;5-propyl-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 143582583 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | (E)-2-methoxy-8,8-dimethylnon-6-enamide;5-propyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CCCN1C(=O)CCOc2ccccc21.COC(CCC/C=C/C(C)(C)C)C(N)=O |
| InChI | InChI=1S/C12H15NO2.C12H23NO2/c1-2-8-13-10-5-3-4-6-11(10)15-9-7-12(13)14;1-12(2,3)9-7-5-6-8-10(15-4)11(13)14/h3-6H,2,7-9H2,1H3;7,9-10H,5-6,8H2,1-4H3,(H2,13,14)/b;9-7+ |
| InChIKey | FBBQUQSNXBNWPO-FXDYKFNQSA-N |
| XLogP | 4.47 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|