C27H39NO2 — CID 143582650
1-benzyl-4-[2-[(4,5-dimethoxy-2-methylphenyl)methyl]pentyl]piperidine (PubChem CID 143582650) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is 1-benzyl-4-[2-[(4,5-dimethoxy-2-methylphenyl)methyl]pentyl]piperidine.
| Compound Name | 1-benzyl-4-[2-[(4,5-dimethoxy-2-methylphenyl)methyl]pentyl]piperidine |
|---|---|
| PubChem CID | 143582650 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | 1-benzyl-4-[2-[(4,5-dimethoxy-2-methylphenyl)methyl]pentyl]piperidine |
| SMILES | CCCC(Cc1cc(OC)c(OC)cc1C)CC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H39NO2/c1-5-9-24(18-25-19-27(30-4)26(29-3)16-21(25)2)17-22-12-14-28(15-13-22)20-23-10-7-6-8-11-23/h6-8,10-11,16,19,22,24H,5,9,12-15,17-18,20H2,1-4H3 |
| InChIKey | NPRZXRBNYAHCQQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |