C26H37NO2 — CID 143582635
1-benzyl-4-[2-[(4,5-dimethoxy-2-methylphenyl)methyl]butyl]piperidine (PubChem CID 143582635) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 1-benzyl-4-[2-[(4,5-dimethoxy-2-methylphenyl)methyl]butyl]piperidine.
| Compound Name | 1-benzyl-4-[2-[(4,5-dimethoxy-2-methylphenyl)methyl]butyl]piperidine |
|---|---|
| PubChem CID | 143582635 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | 1-benzyl-4-[2-[(4,5-dimethoxy-2-methylphenyl)methyl]butyl]piperidine |
| SMILES | CCC(Cc1cc(OC)c(OC)cc1C)CC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H37NO2/c1-5-21(17-24-18-26(29-4)25(28-3)15-20(24)2)16-22-11-13-27(14-12-22)19-23-9-7-6-8-10-23/h6-10,15,18,21-22H,5,11-14,16-17,19H2,1-4H3 |
| InChIKey | RWJHUMAGGGYUSD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |