C30H35N5O5 — CID 143583284
3-[1-ethyl-7-[4-[2-hydroxyethyl(propyl)amino]anilino]-2-oxo-1,6-naphthyridin-3-yl]-N,5-dimethoxybenzamide (PubChem CID 143583284) has the molecular formula C30H35N5O5 and a molecular weight of 545.64 g/mol. Its IUPAC name is 3-[1-ethyl-7-[4-[2-hydroxyethyl(propyl)amino]anilino]-2-oxo-1,6-naphthyridin-3-yl]-N,5-dimethoxybenzamide.
| Compound Name | 3-[1-ethyl-7-[4-[2-hydroxyethyl(propyl)amino]anilino]-2-oxo-1,6-naphthyridin-3-yl]-N,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 143583284 |
| Molecular Formula | C30H35N5O5 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 3-[1-ethyl-7-[4-[2-hydroxyethyl(propyl)amino]anilino]-2-oxo-1,6-naphthyridin-3-yl]-N,5-dimethoxybenzamide |
| SMILES | CCCN(CCO)c1ccc(Nc2cc3c(cn2)cc(-c2cc(OC)cc(C(=O)NOC)c2)c(=O)n3CC)cc1 |
| InChI | InChI=1S/C30H35N5O5/c1-5-11-34(12-13-36)24-9-7-23(8-10-24)32-28-18-27-22(19-31-28)17-26(30(38)35(27)6-2)20-14-21(29(37)33-40-4)16-25(15-20)39-3/h7-10,14-19,36H,5-6,11-13H2,1-4H3,(H,31,32)(H,33,37) |
| InChIKey | FAEAKLKKCUMPGM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|