C34H39N5O4 — CID 162716483
2-[2-[[3-(3,5-dimethoxyphenyl)-2-oxo-1-(3-piperidin-1-ylpropyl)-1,6-naphthyridin-7-yl]amino]-3-methylphenyl]prop-2-enamide (PubChem CID 162716483) has the molecular formula C34H39N5O4 and a molecular weight of 581.72 g/mol. Its IUPAC name is 2-[2-[[3-(3,5-dimethoxyphenyl)-2-oxo-1-(3-piperidin-1-ylpropyl)-1,6-naphthyridin-7-yl]amino]-3-methylphenyl]prop-2-enamide.
| Compound Name | 2-[2-[[3-(3,5-dimethoxyphenyl)-2-oxo-1-(3-piperidin-1-ylpropyl)-1,6-naphthyridin-7-yl]amino]-3-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162716483 |
| Molecular Formula | C34H39N5O4 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | 2-[2-[[3-(3,5-dimethoxyphenyl)-2-oxo-1-(3-piperidin-1-ylpropyl)-1,6-naphthyridin-7-yl]amino]-3-methylphenyl]prop-2-enamide |
| SMILES | C=C(C(N)=O)c1cccc(C)c1Nc1cc2c(cn1)cc(-c1cc(OC)cc(OC)c1)c(=O)n2CCCN1CCCCC1 |
| InChI | InChI=1S/C34H39N5O4/c1-22-10-8-11-28(23(2)33(35)40)32(22)37-31-20-30-25(21-36-31)18-29(24-16-26(42-3)19-27(17-24)43-4)34(41)39(30)15-9-14-38-12-6-5-7-13-38/h8,10-11,16-21H,2,5-7,9,12-15H2,1,3-4H3,(H2,35,40)(H,36,37) |
| InChIKey | UMDBQCHFTQBKJT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|