C29H31F7N2O3 — CID 143583330
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-7-(4-hydroxy-4-methylpiperidin-1-yl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 143583330) has the molecular formula C29H31F7N2O3 and a molecular weight of 588.56 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-7-(4-hydroxy-4-methylpiperidin-1-yl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-7-(4-hydroxy-4-methylpiperidin-1-yl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 143583330 |
| Molecular Formula | C29H31F7N2O3 |
| Molecular Weight | 588.56 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(4-fluorophenyl)-7-(4-hydroxy-4-methylpiperidin-1-yl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC1(O)CCN(C2CC(=O)N3CC(OCc4cc(C(F)(F)F)cc(C(F)(F)F)c4)C(c4ccc(F)cc4)C3C2)CC1 |
| InChI | InChI=1S/C29H31F7N2O3/c1-27(40)6-8-37(9-7-27)22-13-23-26(18-2-4-21(30)5-3-18)24(15-38(23)25(39)14-22)41-16-17-10-19(28(31,32)33)12-20(11-17)29(34,35)36/h2-5,10-12,22-24,26,40H,6-9,13-16H2,1H3 |
| InChIKey | OYGXSUSCUYOFSR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |