C30H32F7N2O3P — CID 143583400
(2R)-7-(1-acetylpiperidin-4-yl)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-phosphanylmethoxy]-1-(4-fluorophenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 143583400) has the molecular formula C30H32F7N2O3P and a molecular weight of 632.56 g/mol. Its IUPAC name is (2R)-7-(1-acetylpiperidin-4-yl)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-phosphanylmethoxy]-1-(4-fluorophenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (2R)-7-(1-acetylpiperidin-4-yl)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-phosphanylmethoxy]-1-(4-fluorophenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 143583400 |
| Molecular Formula | C30H32F7N2O3P |
| Molecular Weight | 632.56 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | (2R)-7-(1-acetylpiperidin-4-yl)-2-[(R)-[3,5-bis(trifluoromethyl)phenyl]-phosphanylmethoxy]-1-(4-fluorophenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(=O)N1CCC(C2CC(=O)N3C[C@H](O[C@H](P)c4cc(C(F)(F)F)cc(C(F)(F)F)c4)C(c4ccc(F)cc4)C3C2)CC1 |
| InChI | InChI=1S/C30H32F7N2O3P/c1-16(40)38-8-6-17(7-9-38)19-12-24-27(18-2-4-23(31)5-3-18)25(15-39(24)26(41)13-19)42-28(43)20-10-21(29(32,33)34)14-22(11-20)30(35,36)37/h2-5,10-11,14,17,19,24-25,27-28H,6-9,12-13,15,43H2,1H3/t19?,24?,25-,27?,28+/m0/s1 |
| InChIKey | ADYNYZYVMICXKP-LMHRPIJISA-N |
| XLogP | 6.79 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.56 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|