C24H20F7NO3 — CID 89135503
(1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-1,2,3,7,8,8a-hexahydroindolizine-5,6-dione (PubChem CID 89135503) has the molecular formula C24H20F7NO3 and a molecular weight of 503.41 g/mol. Its IUPAC name is (1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-1,2,3,7,8,8a-hexahydroindolizine-5,6-dione.
| Compound Name | (1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-1,2,3,7,8,8a-hexahydroindolizine-5,6-dione |
|---|---|
| PubChem CID | 89135503 |
| Molecular Formula | C24H20F7NO3 |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | (1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-1,2,3,7,8,8a-hexahydroindolizine-5,6-dione |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)C(=O)CC[C@H]2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F7NO3/c1-12(14-8-15(23(26,27)28)10-16(9-14)24(29,30)31)35-20-11-32-18(6-7-19(33)22(32)34)21(20)13-2-4-17(25)5-3-13/h2-5,8-10,12,18,20-21H,6-7,11H2,1H3/t12-,18+,20+,21+/m1/s1 |
| InChIKey | CCBPPPHAFJWZJD-UDOIGCHKSA-N |
| XLogP | 5.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|