C24H23F7N2O2 — CID 24750570
(2S,6R,7S,8S)-2-amino-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 24750570) has the molecular formula C24H23F7N2O2 and a molecular weight of 504.45 g/mol. Its IUPAC name is (2S,6R,7S,8S)-2-amino-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (2S,6R,7S,8S)-2-amino-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 24750570 |
| Molecular Formula | C24H23F7N2O2 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | (2S,6R,7S,8S)-2-amino-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)[C@@](C)(N)C[C@H]2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H23F7N2O2/c1-12(14-7-15(23(26,27)28)9-16(8-14)24(29,30)31)35-19-11-33-18(10-22(2,32)21(33)34)20(19)13-3-5-17(25)6-4-13/h3-9,12,18-20H,10-11,32H2,1-2H3/t12-,18+,19+,20+,22+/m1/s1 |
| InChIKey | IYWBQXLNIKBVMG-ZTJYYJHDSA-N |
| XLogP | 5.43 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |