C28H28F7NO4 — CID 87674934
[(1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7,7-dimethyl-5-oxo-1,2,3,6,8,8a-hexahydroindolizin-6-yl] acetate (PubChem CID 87674934) has the molecular formula C28H28F7NO4 and a molecular weight of 575.52 g/mol. Its IUPAC name is [(1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7,7-dimethyl-5-oxo-1,2,3,6,8,8a-hexahydroindolizin-6-yl] acetate.
| Compound Name | [(1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7,7-dimethyl-5-oxo-1,2,3,6,8,8a-hexahydroindolizin-6-yl] acetate |
|---|---|
| PubChem CID | 87674934 |
| Molecular Formula | C28H28F7NO4 |
| Molecular Weight | 575.52 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | [(1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7,7-dimethyl-5-oxo-1,2,3,6,8,8a-hexahydroindolizin-6-yl] acetate |
| SMILES | CC(=O)OC1C(=O)N2C[C@H](O[C@H](C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H](c3ccc(F)cc3)[C@@H]2CC1(C)C |
| InChI | InChI=1S/C28H28F7NO4/c1-14(17-9-18(27(30,31)32)11-19(10-17)28(33,34)35)39-22-13-36-21(23(22)16-5-7-20(29)8-6-16)12-26(3,4)24(25(36)38)40-15(2)37/h5-11,14,21-24H,12-13H2,1-4H3/t14-,21+,22+,23+,24?/m1/s1 |
| InChIKey | OVFMDTJVUJCEGX-RZCOAQLHSA-N |
| XLogP | 6.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |