C29H24F8N2O2 — CID 87674573
(1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(2-fluoro-4-pyridinyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 87674573) has the molecular formula C29H24F8N2O2 and a molecular weight of 584.51 g/mol. Its IUPAC name is (1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(2-fluoro-4-pyridinyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(2-fluoro-4-pyridinyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 87674573 |
| Molecular Formula | C29H24F8N2O2 |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | (1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(2-fluoro-4-pyridinyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)CC(c3ccnc(F)c3)C[C@H]2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H24F8N2O2/c1-15(18-8-20(28(32,33)34)13-21(9-18)29(35,36)37)41-24-14-39-23(27(24)16-2-4-22(30)5-3-16)10-19(12-26(39)40)17-6-7-38-25(31)11-17/h2-9,11,13,15,19,23-24,27H,10,12,14H2,1H3/t15-,19?,23+,24+,27+/m1/s1 |
| InChIKey | DVSBYYKBWCFVJS-FTKJTGMBSA-N |
| XLogP | 7.42 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|