C28H25F7N2O3 — CID 24769160
7-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-8-(4-fluorophenyl)-2-(3-oxocyclopenten-1-yl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 24769160) has the molecular formula C28H25F7N2O3 and a molecular weight of 570.51 g/mol. Its IUPAC name is 7-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-8-(4-fluorophenyl)-2-(3-oxocyclopenten-1-yl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | 7-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-8-(4-fluorophenyl)-2-(3-oxocyclopenten-1-yl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 24769160 |
| Molecular Formula | C28H25F7N2O3 |
| Molecular Weight | 570.51 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 7-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-8-(4-fluorophenyl)-2-(3-oxocyclopenten-1-yl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | CC(OC1CN2C(=O)CN(C3=CC(=O)CC3)CC2C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H25F7N2O3/c1-15(17-8-18(27(30,31)32)10-19(9-17)28(33,34)35)40-24-13-37-23(26(24)16-2-4-20(29)5-3-16)12-36(14-25(37)39)21-6-7-22(38)11-21/h2-5,8-11,15,23-24,26H,6-7,12-14H2,1H3 |
| InChIKey | XELKBNDRVWZLPA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |