C23H22F7NO3 — CID 143583407
[3,5-bis(trifluoromethyl)phenyl]methanol;1-(4-fluorophenyl)-7-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 143583407) has the molecular formula C23H22F7NO3 and a molecular weight of 493.42 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methanol;1-(4-fluorophenyl)-7-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methanol;1-(4-fluorophenyl)-7-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 143583407 |
| Molecular Formula | C23H22F7NO3 |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methanol;1-(4-fluorophenyl)-7-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | O=C1CC(O)CC2C(c3ccc(F)cc3)CCN12.OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16FNO2.C9H6F6O/c15-10-3-1-9(2-4-10)12-5-6-16-13(12)7-11(17)8-14(16)18;10-8(11,12)6-1-5(4-16)2-7(3-6)9(13,14)15/h1-4,11-13,17H,5-8H2;1-3,16H,4H2 |
| InChIKey | OFLKMKLLTCVDLW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |