C25H32N4O3 — CID 143584534
(2S)-N-(3,4-dihydro-2H-naphthalen-1-ylidene)-1-[(2S)-2-[[(2S)-2-(methylamino)butanoyl]amino]pent-4-ynoyl]pyrrolidine-2-carboxamide (PubChem CID 143584534) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is (2S)-N-(3,4-dihydro-2H-naphthalen-1-ylidene)-1-[(2S)-2-[[(2S)-2-(methylamino)butanoyl]amino]pent-4-ynoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(3,4-dihydro-2H-naphthalen-1-ylidene)-1-[(2S)-2-[[(2S)-2-(methylamino)butanoyl]amino]pent-4-ynoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143584534 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (2S)-N-(3,4-dihydro-2H-naphthalen-1-ylidene)-1-[(2S)-2-[[(2S)-2-(methylamino)butanoyl]amino]pent-4-ynoyl]pyrrolidine-2-carboxamide |
| SMILES | C#CC[C@H](NC(=O)[C@H](CC)NC)C(=O)N1CCC[C@H]1C(=O)/N=C1\CCCc2ccccc21 |
| InChI | InChI=1S/C25H32N4O3/c1-4-10-21(28-23(30)19(5-2)26-3)25(32)29-16-9-15-22(29)24(31)27-20-14-8-12-17-11-6-7-13-18(17)20/h1,6-7,11,13,19,21-22,26H,5,8-10,12,14-16H2,2-3H3,(H,28,30)/b27-20+/t19-,21-,22-/m0/s1 |
| InChIKey | NFMGUHSYCJUAKK-SXALQYHSSA-N |
| XLogP | 1.84 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|