C23H37N5O2 — CID 143585536
[N'-[4-(diethylamino)butyl]carbamimidoyl] 4-(cyclohexanecarbonylamino)benzenecarboximidate (PubChem CID 143585536) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is [N'-[4-(diethylamino)butyl]carbamimidoyl] 4-(cyclohexanecarbonylamino)benzenecarboximidate.
| Compound Name | [N'-[4-(diethylamino)butyl]carbamimidoyl] 4-(cyclohexanecarbonylamino)benzenecarboximidate |
|---|---|
| PubChem CID | 143585536 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | [N'-[4-(diethylamino)butyl]carbamimidoyl] 4-(cyclohexanecarbonylamino)benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(N)=N/CCCCN(CC)CC)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H37N5O2/c1-3-28(4-2)17-9-8-16-26-23(25)30-21(24)18-12-14-20(15-13-18)27-22(29)19-10-6-5-7-11-19/h12-15,19,24H,3-11,16-17H2,1-2H3,(H2,25,26)(H,27,29)/b24-21- |
| InChIKey | NWGWRNJLGVEINC-FLFQWRMESA-N |
| XLogP | 3.98 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|