C17H28O — CID 143586825
4-(2,3-dimethylbut-3-enyl)phenol;ethane;prop-1-ene (PubChem CID 143586825) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 4-(2,3-dimethylbut-3-enyl)phenol;ethane;prop-1-ene.
| Compound Name | 4-(2,3-dimethylbut-3-enyl)phenol;ethane;prop-1-ene |
|---|---|
| PubChem CID | 143586825 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 4-(2,3-dimethylbut-3-enyl)phenol;ethane;prop-1-ene |
| SMILES | C=C(C)C(C)Cc1ccc(O)cc1.C=CC.CC |
| InChI | InChI=1S/C12H16O.C3H6.C2H6/c1-9(2)10(3)8-11-4-6-12(13)7-5-11;1-3-2;1-2/h4-7,10,13H,1,8H2,2-3H3;3H,1H2,2H3;1-2H3 |
| InChIKey | UAFBEPQJSGGCTJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|