C19H19ClO — CID 143842918
(4-chlorophenyl)-[4-(2,3-dimethylbut-3-enyl)phenyl]methanone (PubChem CID 143842918) has the molecular formula C19H19ClO and a molecular weight of 298.81 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-(2,3-dimethylbut-3-enyl)phenyl]methanone.
| Compound Name | (4-chlorophenyl)-[4-(2,3-dimethylbut-3-enyl)phenyl]methanone |
|---|---|
| PubChem CID | 143842918 |
| Molecular Formula | C19H19ClO |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (4-chlorophenyl)-[4-(2,3-dimethylbut-3-enyl)phenyl]methanone |
| SMILES | C=C(C)C(C)Cc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H19ClO/c1-13(2)14(3)12-15-4-6-16(7-5-15)19(21)17-8-10-18(20)11-9-17/h4-11,14H,1,12H2,2-3H3 |
| InChIKey | DDXFPOHHOHMETB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|