C26H25N5O2 — CID 143589403
3-[2-amino-4-hydroxy-5-[2-(4-methylphenyl)ethyl]phenyl]-4-(1-methylindol-5-yl)-1H-1,2,4-triazol-5-one (PubChem CID 143589403) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-[2-amino-4-hydroxy-5-[2-(4-methylphenyl)ethyl]phenyl]-4-(1-methylindol-5-yl)-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[2-amino-4-hydroxy-5-[2-(4-methylphenyl)ethyl]phenyl]-4-(1-methylindol-5-yl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 143589403 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3-[2-amino-4-hydroxy-5-[2-(4-methylphenyl)ethyl]phenyl]-4-(1-methylindol-5-yl)-1H-1,2,4-triazol-5-one |
| SMILES | Cc1ccc(CCc2cc(-c3n[nH]c(=O)n3-c3ccc4c(ccn4C)c3)c(N)cc2O)cc1 |
| InChI | InChI=1S/C26H25N5O2/c1-16-3-5-17(6-4-16)7-8-19-14-21(22(27)15-24(19)32)25-28-29-26(33)31(25)20-9-10-23-18(13-20)11-12-30(23)2/h3-6,9-15,32H,7-8,27H2,1-2H3,(H,29,33) |
| InChIKey | XAWQAVZDBBTJHI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|