C23H34N4O4S — CID 143589602
N-[[4-methoxy-3-[methyl(propyl)amino]phenyl]carbamothioylamino]formamide;4-methyl-6-propan-2-ylbenzene-1,3-diol (PubChem CID 143589602) has the molecular formula C23H34N4O4S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-[[4-methoxy-3-[methyl(propyl)amino]phenyl]carbamothioylamino]formamide;4-methyl-6-propan-2-ylbenzene-1,3-diol.
| Compound Name | N-[[4-methoxy-3-[methyl(propyl)amino]phenyl]carbamothioylamino]formamide;4-methyl-6-propan-2-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 143589602 |
| Molecular Formula | C23H34N4O4S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-[[4-methoxy-3-[methyl(propyl)amino]phenyl]carbamothioylamino]formamide;4-methyl-6-propan-2-ylbenzene-1,3-diol |
| SMILES | CCCN(C)c1cc(NC(=S)NNC=O)ccc1OC.Cc1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C13H20N4O2S.C10H14O2/c1-4-7-17(2)11-8-10(5-6-12(11)19-3)15-13(20)16-14-9-18;1-6(2)8-4-7(3)9(11)5-10(8)12/h5-6,8-9H,4,7H2,1-3H3,(H,14,18)(H2,15,16,20);4-6,11-12H,1-3H3 |
| InChIKey | PEBRADLUECRGPQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|