C23H32N4O3S — CID 89219093
3-amino-1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-1-[4-methoxy-3-[methyl(propyl)amino]phenyl]thiourea (PubChem CID 89219093) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is 3-amino-1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-1-[4-methoxy-3-[methyl(propyl)amino]phenyl]thiourea.
| Compound Name | 3-amino-1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-1-[4-methoxy-3-[methyl(propyl)amino]phenyl]thiourea |
|---|---|
| PubChem CID | 89219093 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 3-amino-1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-1-[4-methoxy-3-[methyl(propyl)amino]phenyl]thiourea |
| SMILES | C=C(c1cc(C(C)C)c(O)cc1O)N(C(=S)NN)c1ccc(OC)c(N(C)CCC)c1 |
| InChI | InChI=1S/C23H32N4O3S/c1-7-10-26(5)19-11-16(8-9-22(19)30-6)27(23(31)25-24)15(4)18-12-17(14(2)3)20(28)13-21(18)29/h8-9,11-14,28-29H,4,7,10,24H2,1-3,5-6H3,(H,25,31) |
| InChIKey | ZYJIIOMJUHDGPU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|