C25H20ClF3N4OS — CID 143594430
8-[3-(3-chlorophenyl)phenyl]-8-[3-(trifluoromethylsulfanyloxy)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine (PubChem CID 143594430) has the molecular formula C25H20ClF3N4OS and a molecular weight of 516.98 g/mol. Its IUPAC name is 8-[3-(3-chlorophenyl)phenyl]-8-[3-(trifluoromethylsulfanyloxy)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine.
| Compound Name | 8-[3-(3-chlorophenyl)phenyl]-8-[3-(trifluoromethylsulfanyloxy)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine |
|---|---|
| PubChem CID | 143594430 |
| Molecular Formula | C25H20ClF3N4OS |
| Molecular Weight | 516.98 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 8-[3-(3-chlorophenyl)phenyl]-8-[3-(trifluoromethylsulfanyloxy)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine |
| SMILES | NC1=NC(c2cccc(OSC(F)(F)F)c2)(c2cccc(-c3cccc(Cl)c3)c2)C2=NCCCN12 |
| InChI | InChI=1S/C25H20ClF3N4OS/c26-20-9-2-6-17(14-20)16-5-1-7-18(13-16)24(22-31-11-4-12-33(22)23(30)32-24)19-8-3-10-21(15-19)34-35-25(27,28)29/h1-3,5-10,13-15H,4,11-12H2,(H2,30,32) |
| InChIKey | WBKOSKJWHWKOMU-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.98 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|