C24H36F3N3O2 — CID 143594688
(1Z,3Z)-buta-1,3-diene-1,4-diamine;N-cyclopropyl-N-(1-hydroxyheptan-4-yl)-4-(1,1,1-trifluoropropan-2-yl)benzamide (PubChem CID 143594688) has the molecular formula C24H36F3N3O2 and a molecular weight of 455.57 g/mol. Its IUPAC name is (1Z,3Z)-buta-1,3-diene-1,4-diamine;N-cyclopropyl-N-(1-hydroxyheptan-4-yl)-4-(1,1,1-trifluoropropan-2-yl)benzamide.
| Compound Name | (1Z,3Z)-buta-1,3-diene-1,4-diamine;N-cyclopropyl-N-(1-hydroxyheptan-4-yl)-4-(1,1,1-trifluoropropan-2-yl)benzamide |
|---|---|
| PubChem CID | 143594688 |
| Molecular Formula | C24H36F3N3O2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | (1Z,3Z)-buta-1,3-diene-1,4-diamine;N-cyclopropyl-N-(1-hydroxyheptan-4-yl)-4-(1,1,1-trifluoropropan-2-yl)benzamide |
| SMILES | CCCC(CCCO)N(C(=O)c1ccc(C(C)C(F)(F)F)cc1)C1CC1.N/C=C\C=C/N |
| InChI | InChI=1S/C20H28F3NO2.C4H8N2/c1-3-5-17(6-4-13-25)24(18-11-12-18)19(26)16-9-7-15(8-10-16)14(2)20(21,22)23;5-3-1-2-4-6/h7-10,14,17-18,25H,3-6,11-13H2,1-2H3;1-4H,5-6H2/b;3-1-,4-2- |
| InChIKey | VTODUYYMTYVOSS-SSSHPFEYSA-N |
| XLogP | 4.83 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|